Solve: Square Root of (405²+405²×406²+406²) - 405² Expression

Algebraic Simplification with Completing the Square

4052+40524062+40624052= \sqrt{405^2+405^2\cdot406^2+406^2}-405^2=

❤️ Continue Your Math Journey!

We have hundreds of course questions with personalized recommendations + Account 100% premium

Step-by-step video solution

Watch the teacher solve the problem with clear explanations
00:12 Let's solve this problem without a calculator.
00:18 First, we will write four hundred five as the letter X.
00:26 Now, substitute X into the exercise, just like this.
00:40 We'll use some multiplication formulas to open the parentheses.
00:54 Carefully, multiply each factor inside the parentheses.
01:11 Let's arrange everything neatly now.
01:23 Next, we group similar terms together. This helps simplify.
01:41 Use the formulas to convert parentheses into squares.
01:46 Remember: the square root of a squared term is the term itself.
01:52 Now, simplify as much as you can.
01:57 Replace X back with four hundred five and solve.
02:03 And that's how we find the solution to the question.

Step-by-step written solution

Follow each step carefully to understand the complete solution
1

Understand the problem

4052+40524062+40624052= \sqrt{405^2+405^2\cdot406^2+406^2}-405^2=

2

Step-by-step solution

Let's examine the problem:

4052+40524062+40624052= \sqrt{405^2+405^2\cdot406^2+406^2}-405^2=

We'll focus on the expression under the square root. For calculation without a calculator, we naturally want to find a way to eliminate the square root. To do this, we need to transform the expression inside the root into a squared expression, which we'll try to do using the squared binomial formula in two main steps:

First - for simplicity of calculation and generality of solution let's denote:

406=a405=a1 406=a\rightarrow405=a-1

therefore the expression under the root is:

4052+40524062+4062(a1)2+(a1)2a2+a2 405^2+405^2\cdot406^2+406^2\\ \downarrow\\ (a-1)^2+(a-1)^2a^2+a^2

Step A.

We'll use a method called: "completing the square" In this method, we make the expression appear in the form of a squared binomial plus a correction term, meaning we "rearrange" the formula by moving terms within the formula itself, and use the standard form to get a structure similar to the squared binomial form:

b22bc+c2=(bc)2b2+c2=(bc)2+2bc \boxed{ b^2-2bc+c^2= (b-c)^2}\\ \downarrow\\ \textcolor{blue}{b^2+c^2=(b-c)^2+2bc}

Note that we can use this method on the expression in question (under the root), if we now denote:

a1=ba=c \textcolor{red}{ a-1=b\\ a=c }

we get:

(a1)2+(a1)2a2+a2b2+b2c2+c2b2+c2+b2c2 (a-1)^2+(a-1)^2a^2+a^2 \\ \downarrow\\ b^2+b^2c^2+c^2\\ b^2+c^2+b^2c^2

We'll use the "rearranged" formula we got earlier (highlighted in blue) and substitute it in the last expression we got:

4052+40524062+4062(a1)2+a2(a1)2+a2b2+b2c2+c2b2+c2+b2c2(bc)2+2bc+b2c2 405^2+405^2\cdot406^2+406^2\\ \downarrow\\ (a-1)^2+a^2(a-1)^2+a^2 \\ \downarrow\\ b^2+b^2c^2+c^2\\ \textcolor{blue}{b^2+c^2}+b^2c^2 \\ \downarrow\\ \textcolor{blue}{(b-c)^2+2bc}+b^2c^2

Now we'll return to parameter a using the definitions for b and c that we defined earlier (in red):

4052+40524062+4062(a1)2+a2(a1)2+a2b2+b2c2+c2b2+c2+b2c2(bc)2+2bc+b2c2((a1)a)2+2(a1)a+(a1)2a2 405^2+405^2\cdot406^2+406^2\\ \downarrow\\ (a-1)^2+a^2(a-1)^2+a^2 \\ \downarrow\\ b^2+b^2c^2+c^2\\ \textcolor{blue}{b^2+c^2}+b^2c^2 \\ \downarrow\\ \textcolor{blue}{(b-c)^2+2bc}+b^2c^2 \\ \downarrow\\ ((a-1)-a)^2+2(a-1)a+(a-1)^2a^2

where the first steps are just a reminder of what we've done so far and only the final step is substituting the expressions and returning to parameter a,

Let's continue and simplify the first term on the left in the expression we got:

((a1)a)2+2(a1)a+(a1)2a21+2(a1)a+(a1)2a2 \textcolor{green}{ ((a-1)-a)^2}+2(a-1)a+(a-1)^2a^2 \\ \downarrow\\ \textcolor{green}{1}+2(a-1)a+(a-1)^2a^2

Step B.

Now we'll use the laws of exponents:

xnyn=(xy)2 \boxed{x^ny^n=(xy)^2}

and we'll express the third term from the left as a power:

1+2(a1)a+(a1)2a21+2(a1)a+((a1)a)2 1+2(a-1)a+\textcolor{red}{(a-1)^2a^2} \\ 1+2(a-1)a+\textcolor{red}{((a-1)a)^2}

Now let's rearrange, and factor using the shortened multiplication formula for squared binomial (in its addition form):

1+2(a1)a+((a1)a)2((a1)a)2+2(a1)a1+12((a1)a+1)2 1+2(a-1)a+((a-1)a)^2 \\ \downarrow\\ (\textcolor{orange}{(a-1)a})^2+2\textcolor{orange}{(a-1)a}\cdot\textcolor{purple}{1}+\textcolor{purple}{1}^2\\ \downarrow\\ (\textcolor{orange}{(a-1)a}+\textcolor{purple}{1})^2

In the next step the square root will cancel out the squared power, which was actually the whole purpose of this development (let's summarize the solution steps):

4052+40524062+40624052=(a1)2+(a1)2a2+a2(a1)2=(a1)2+a2+(a1)2a2(a1)2=((a1)a)2+2(a1)a+(a1)2a2(a1)2((a1)a)2+2(a1)a1+12(a1)2((a1)a+1)2(a1)2((a1)a+1)2(a1)2=(a1)a+1(a1)2 \sqrt{405^2+405^2\cdot406^2+406^2}-405^2= \\ \downarrow\\ \sqrt{(a-1)^2+(a-1)^2a^2+a^2 }-(a-1)^2= \\ \downarrow\\ \sqrt{\textcolor{red}{(a-1)^2+a^2}+(a-1)^2a^2 }-(a-1)^2= \\ \downarrow\\ \sqrt{\textcolor{red}{((a-1)-a)^2+2(a-1)a}+(a-1)^2a^2}-(a-1)^2\\ \downarrow\\ \sqrt{(\textcolor{orange}{(a-1)a})^2+2\textcolor{orange}{(a-1)a}\cdot\textcolor{purple}{1}+\textcolor{purple}{1}^2}-(a-1)^2\\ \downarrow\\ \sqrt{(\textcolor{orange}{(a-1)a}+\textcolor{purple}{1})^2}-(a-1)^2\\ \downarrow\\ \sqrt{((a-1)a+1)^2}-(a-1)^2= \\ \downarrow\\ (a-1)a+1-(a-1)^2

We achieved our goal - we eliminated the root

Completing the solution:

Now we just need to expand the parentheses using the shortened multiplication formula for squared binomial and the distributive law, and then simplify the resulting expression:

(a1)a+1(a1)2a2a+1(a22a+1)a2a+1a2+2a1=a (a-1)a+1-(a-1)^2\\ \downarrow\\ a^2-a+1-(a^2-2a+1)\\ a^2-a+1-a^2+2a-1=\\ a

Therefore we got that the result of simplifying the expression is simply:

4052+40524062+40624052=(a1)2+a2(a1)2+a2(a1)2=a=406 \sqrt{405^2+405^2\cdot406^2+406^2}-405^2= \\ \downarrow\\ \sqrt{(a-1)^2+a^2(a-1)^2+a^2 }-(a-1)^2= \\ a=406

Therefore the correct answer is answer B

Note and additional question:

Note that the calculation was done in general form for parameter a, so now let's ask,

What will be the result of simplifying the expression?

14142+1414214152+1415214142=? \sqrt{1414^2+1414^2\cdot1415^2+1415^2}-1414^2=?

3

Final Answer

406 406

Key Points to Remember

Essential concepts to master this topic
  • Pattern Recognition: Transform complex expressions using completing the square technique
  • Substitution: Let a = 406, then 405 = a-1 to simplify calculations
  • Verification: Check that ((a1)a+1)2=(a1)a+1 \sqrt{((a-1)a+1)^2} = (a-1)a+1 gives a = 406 ✓

Common Mistakes

Avoid these frequent errors
  • Attempting to calculate the square root directly without simplification
    Don't try to compute 4052+40524062+4062 \sqrt{405^2+405^2\cdot406^2+406^2} by expanding all terms = massive calculations with errors! This leads to computational mistakes and wrong answers. Always look for patterns first and use completing the square to transform the expression under the radical into a perfect square.

Practice Quiz

Test your knowledge with interactive questions

Solve the following expression:

\( x^2-1=0 \)

FAQ

Everything you need to know about this question

Why substitute a = 406 and 405 = a-1?

+

This substitution makes the pattern clearer! Instead of working with specific large numbers like 405 and 406, using a and a-1 helps you see the algebraic structure and apply completing the square more easily.

How do I know when to use completing the square?

+

Look for expressions under a square root that have the form x2+xy2+y2 x^2 + xy^2 + y^2 . This pattern suggests you can rearrange terms to create a perfect square trinomial that will eliminate the radical.

What if I can't see the pattern right away?

+

Start by factoring out common terms or using substitution to simplify. In this case, both numbers are consecutive integers (405, 406), which is a strong hint to use substitution like a and a-1.

Why does the final answer equal just 406?

+

After completing the square and simplifying, we get (a1)a+1(a1)2 (a-1)a + 1 - (a-1)^2 . When you expand and combine like terms, everything cancels except a, which equals 406!

Can this method work for other consecutive integers?

+

Absolutely! The same pattern works for any consecutive integers. For example, with 1414 and 1415, you'd get 1415 as the final answer using the exact same technique.

🌟 Unlock Your Math Potential

Get unlimited access to all 18 Factorization questions, detailed video solutions, and personalized progress tracking.

📹

Unlimited Video Solutions

Step-by-step explanations for every problem

📊

Progress Analytics

Track your mastery across all topics

🚫

Ad-Free Learning

Focus on math without distractions

No credit card required • Cancel anytime

More Questions

Click on any question to see the complete solution with step-by-step explanations